About 5-bromopyridine-2,3-diamine;hydrochloride
5-bromopyridine-2,3-diamine;hydrochloride (PubChem CID 77174586) has the molecular formula C5H7BrClN3
and a molecular weight of 224.49 g/mol. Its IUPAC name is 5-bromopyridine-2,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | 5-bromopyridine-2,3-diamine;hydrochloride |
| PubChem CID | 77174586 |
| Molecular Formula | C5H7BrClN3 |
| Molecular Weight | 224.49 g/mol |
| Exact Mass | 222.95 |
| IUPAC Name | 5-bromopyridine-2,3-diamine;hydrochloride |
| SMILES | Cl.Nc1cc(Br)cnc1N |
| InChI | InChI=1S/C5H6BrN3.ClH/c6-3-1-4(7)5(8)9-2-3;/h1-2H,7H2,(H2,8,9);1H |
| InChIKey | OHXJNYRFEFECGD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromopyridine-2,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopyridine-2,3-diamine;hydrochloride?
The IUPAC name of 5-bromopyridine-2,3-diamine;hydrochloride (CID 77174586) is 5-bromopyridine-2,3-diamine;hydrochloride.
What is the SMILES notation for 5-bromopyridine-2,3-diamine;hydrochloride?
The canonical SMILES for 5-bromopyridine-2,3-diamine;hydrochloride is Cl.Nc1cc(Br)cnc1N.
What is the InChIKey of 5-bromopyridine-2,3-diamine;hydrochloride?
The InChIKey is OHXJNYRFEFECGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrN3.ClH/c6-3-1-4(7)5(8)9-2-3;/h1-2H,7H2,(H2,8,9);1H.
What are the key properties of 5-bromopyridine-2,3-diamine;hydrochloride?
5-bromopyridine-2,3-diamine;hydrochloride has a molecular weight of 224.49 g/mol, XLogP of 1.43, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopyridine-2,3-diamine;hydrochloride is sourced from PubChem (CID 77174586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).