About 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde
4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 77174725) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde |
| PubChem CID | 77174725 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | COC1=CC(C=O)=CC(OC)C1(O)C(C)=O |
| InChI | InChI=1S/C11H14O5/c1-7(13)11(14)9(15-2)4-8(6-12)5-10(11)16-3/h4-6,9,14H,1-3H3 |
| InChIKey | JLESQKIMSKNNJM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde?
The IUPAC name of 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde (CID 77174725) is 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde.
What is the SMILES notation for 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde?
The canonical SMILES for 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde is COC1=CC(C=O)=CC(OC)C1(O)C(C)=O.
What is the InChIKey of 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde?
The InChIKey is JLESQKIMSKNNJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O5/c1-7(13)11(14)9(15-2)4-8(6-12)5-10(11)16-3/h4-6,9,14H,1-3H3.
What are the key properties of 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde?
4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde has a molecular weight of 226.23 g/mol, XLogP of -0.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde is sourced from PubChem (CID 77174725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).