About 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol
7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol (PubChem CID 77174779) has the molecular formula C6H6O2S
and a molecular weight of 142.18 g/mol. Its IUPAC name is 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol.
Molecular Properties
| Compound Name | 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol |
| PubChem CID | 77174779 |
| Molecular Formula | C6H6O2S |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol |
| SMILES | OC1=CC=CC2(O)SC12 |
| InChI | InChI=1S/C6H6O2S/c7-4-2-1-3-6(8)5(4)9-6/h1-3,5,7-8H |
| InChIKey | XJNHUSFVTDWFFU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol?
The IUPAC name of 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol (CID 77174779) is 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol.
What is the SMILES notation for 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol?
The canonical SMILES for 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol is OC1=CC=CC2(O)SC12.
What is the InChIKey of 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol?
The InChIKey is XJNHUSFVTDWFFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2S/c7-4-2-1-3-6(8)5(4)9-6/h1-3,5,7-8H.
What are the key properties of 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol?
7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol has a molecular weight of 142.18 g/mol, XLogP of 0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-thiabicyclo[4.1.0]hepta-2,4-diene-1,5-diol is sourced from PubChem (CID 77174779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).