C5H4Cl2N2O2S — CID 77174813
2,4-dichloro-6-methylsulfonylpyrimidine (PubChem CID 77174813) has the molecular formula C5H4Cl2N2O2S and a molecular weight of 227.07 g/mol. Its IUPAC name is 2,4-dichloro-6-methylsulfonylpyrimidine.
| Compound Name | 2,4-dichloro-6-methylsulfonylpyrimidine |
|---|---|
| PubChem CID | 77174813 |
| Molecular Formula | C5H4Cl2N2O2S |
| Molecular Weight | 227.07 g/mol |
| Exact Mass | 225.94 |
| IUPAC Name | 2,4-dichloro-6-methylsulfonylpyrimidine |
| SMILES | CS(=O)(=O)c1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C5H4Cl2N2O2S/c1-12(10,11)4-2-3(6)8-5(7)9-4/h2H,1H3 |
| InChIKey | NYLCOCPEKIQCAJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.07 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |