5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid

C7H11NO3 — CID 77178162

IUPAC5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid
SMILESCCOC1=NC(C(=O)O)CC1
InChIInChI=1S/C7H11NO3/c1-2-11-6-4-3-5(8-6)7(9)10/h5H,2-4H2,1H3,(H,9,10)
InChIKeyKWLBPXDHFVAPRK-UHFFFAOYSA-N
MW157.17 g/mol
LogP0.67
Rot. Bonds2

About 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid

5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid (PubChem CID 77178162) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid.

Molecular Properties

Compound Name5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid
PubChem CID77178162
Molecular FormulaC7H11NO3
Molecular Weight157.17 g/mol
Exact Mass157.07
IUPAC Name5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid
SMILESCCOC1=NC(C(=O)O)CC1
InChIInChI=1S/C7H11NO3/c1-2-11-6-4-3-5(8-6)7(9)10/h5H,2-4H2,1H3,(H,9,10)
InChIKeyKWLBPXDHFVAPRK-UHFFFAOYSA-N
XLogP0.67
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.17
LogP ≤ 50.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The IUPAC name of 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid (CID 77178162) is 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid.
What is the SMILES notation for 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The canonical SMILES for 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid is CCOC1=NC(C(=O)O)CC1.
What is the InChIKey of 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The InChIKey is KWLBPXDHFVAPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-2-11-6-4-3-5(8-6)7(9)10/h5H,2-4H2,1H3,(H,9,10).
What are the key properties of 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 77178162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).