About 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid
5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid (PubChem CID 77178162) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid |
| PubChem CID | 77178162 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid |
| SMILES | CCOC1=NC(C(=O)O)CC1 |
| InChI | InChI=1S/C7H11NO3/c1-2-11-6-4-3-5(8-6)7(9)10/h5H,2-4H2,1H3,(H,9,10) |
| InChIKey | KWLBPXDHFVAPRK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The IUPAC name of 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid (CID 77178162) is 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid.
What is the SMILES notation for 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The canonical SMILES for 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid is CCOC1=NC(C(=O)O)CC1.
What is the InChIKey of 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
The InChIKey is KWLBPXDHFVAPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-2-11-6-4-3-5(8-6)7(9)10/h5H,2-4H2,1H3,(H,9,10).
What are the key properties of 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid?
5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 77178162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).