About N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide
N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide (PubChem CID 77179711) has the molecular formula C22H40N2O3
and a molecular weight of 380.57 g/mol. Its IUPAC name is N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide.
Molecular Properties
| Compound Name | N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide |
| PubChem CID | 77179711 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCC1CC(=O)NO1 |
| InChI | InChI=1S/C22H40N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)23-19-20-18-22(26)24-27-20/h9-10,20H,2-8,11-19H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | JCBPBGQGANTFAM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide?
The IUPAC name of N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide (CID 77179711) is N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide.
What is the SMILES notation for N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide?
The canonical SMILES for N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide is CCCCCCCCC=CCCCCCCCC(=O)NCC1CC(=O)NO1.
What is the InChIKey of N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide?
The InChIKey is JCBPBGQGANTFAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)23-19-20-18-22(26)24-27-20/h9-10,20H,2-8,11-19H2,1H3,(H,23,25)(H,24,26).
What are the key properties of N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide?
N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide has a molecular weight of 380.57 g/mol, XLogP of 4.96, 17 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadec-9-enamide is sourced from PubChem (CID 77179711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).