C22H38N2O3 — CID 77179722
N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadeca-9,12-dienamide (PubChem CID 77179722) has the molecular formula C22H38N2O3 and a molecular weight of 378.56 g/mol. Its IUPAC name is N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadeca-9,12-dienamide.
| Compound Name | N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 77179722 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]octadeca-9,12-dienamide |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NCC1CC(=O)NO1 |
| InChI | InChI=1S/C22H38N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)23-19-20-18-22(26)24-27-20/h6-7,9-10,20H,2-5,8,11-19H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | KROWECIWXPZPNK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|