About (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate (PubChem CID 7718007) has the molecular formula C16H14N2O3S
and a molecular weight of 314.37 g/mol. Its IUPAC name is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate.
Molecular Properties
| Compound Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate |
| PubChem CID | 7718007 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCc1cc(=O)n2c(C)csc2n1 |
| InChI | InChI=1S/C16H14N2O3S/c1-10-5-3-4-6-13(10)15(20)21-8-12-7-14(19)18-11(2)9-22-16(18)17-12/h3-7,9H,8H2,1-2H3 |
| InChIKey | TXZPAZPLJRBXCT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate?
The IUPAC name of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate (CID 7718007) is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate.
What is the SMILES notation for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate?
The canonical SMILES for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate is Cc1ccccc1C(=O)OCc1cc(=O)n2c(C)csc2n1.
What is the InChIKey of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate?
The InChIKey is TXZPAZPLJRBXCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3S/c1-10-5-3-4-6-13(10)15(20)21-8-12-7-14(19)18-11(2)9-22-16(18)17-12/h3-7,9H,8H2,1-2H3.
What are the key properties of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate?
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate has a molecular weight of 314.37 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylbenzoate is sourced from PubChem (CID 7718007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).