C16H28N2 — CID 77181484
3-(cyclononen-1-yl)-4,5,6,7,8,9-hexahydro-3H-diazonine (PubChem CID 77181484) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 3-(cyclononen-1-yl)-4,5,6,7,8,9-hexahydro-3H-diazonine.
| Compound Name | 3-(cyclononen-1-yl)-4,5,6,7,8,9-hexahydro-3H-diazonine |
|---|---|
| PubChem CID | 77181484 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 3-(cyclononen-1-yl)-4,5,6,7,8,9-hexahydro-3H-diazonine |
| SMILES | C1=C(C2CCCCCC/N=N\2)CCCCCCC1 |
| InChI | InChI=1S/C16H28N2/c1-2-4-8-12-15(11-7-3-1)16-13-9-5-6-10-14-17-18-16/h11,16H,1-10,12-14H2/b15-11?,18-17- |
| InChIKey | VDECQBAHMQSLLJ-SOCDUDDGSA-N |
| XLogP | 5.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|