About 3-(cycloundecen-1-yl)-1,2-diazacycloundecene
3-(cycloundecen-1-yl)-1,2-diazacycloundecene (PubChem CID 77181552) has the molecular formula C20H36N2
and a molecular weight of 304.52 g/mol. Its IUPAC name is 3-(cycloundecen-1-yl)-1,2-diazacycloundecene.
Molecular Properties
| Compound Name | 3-(cycloundecen-1-yl)-1,2-diazacycloundecene |
| PubChem CID | 77181552 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 3-(cycloundecen-1-yl)-1,2-diazacycloundecene |
| SMILES | C1=C(C2CCCCCCCC/N=N\2)CCCCCCCCC1 |
| InChI | InChI=1S/C20H36N2/c1-2-4-8-12-16-19(15-11-7-3-1)20-17-13-9-5-6-10-14-18-21-22-20/h15,20H,1-14,16-18H2/b19-15?,22-21- |
| InChIKey | QSUVDMRJEKZQJP-VLEPGWJTSA-N |
| XLogP | 7.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(cycloundecen-1-yl)-1,2-diazacycloundecene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cycloundecen-1-yl)-1,2-diazacycloundecene?
The IUPAC name of 3-(cycloundecen-1-yl)-1,2-diazacycloundecene (CID 77181552) is 3-(cycloundecen-1-yl)-1,2-diazacycloundecene.
What is the SMILES notation for 3-(cycloundecen-1-yl)-1,2-diazacycloundecene?
The canonical SMILES for 3-(cycloundecen-1-yl)-1,2-diazacycloundecene is C1=C(C2CCCCCCCC/N=N\2)CCCCCCCCC1.
What is the InChIKey of 3-(cycloundecen-1-yl)-1,2-diazacycloundecene?
The InChIKey is QSUVDMRJEKZQJP-VLEPGWJTSA-N. The full InChI is InChI=1S/C20H36N2/c1-2-4-8-12-16-19(15-11-7-3-1)20-17-13-9-5-6-10-14-18-21-22-20/h15,20H,1-14,16-18H2/b19-15?,22-21-.
What are the key properties of 3-(cycloundecen-1-yl)-1,2-diazacycloundecene?
3-(cycloundecen-1-yl)-1,2-diazacycloundecene has a molecular weight of 304.52 g/mol, XLogP of 7.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cycloundecen-1-yl)-1,2-diazacycloundecene is sourced from PubChem (CID 77181552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).