C18H32N2 — CID 77181591
3-(cyclodecen-1-yl)-3,4,5,6,7,8,9,10-octahydrodiazecine (PubChem CID 77181591) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 3-(cyclodecen-1-yl)-3,4,5,6,7,8,9,10-octahydrodiazecine.
| Compound Name | 3-(cyclodecen-1-yl)-3,4,5,6,7,8,9,10-octahydrodiazecine |
|---|---|
| PubChem CID | 77181591 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 3-(cyclodecen-1-yl)-3,4,5,6,7,8,9,10-octahydrodiazecine |
| SMILES | C1=C(C2CCCCCCC/N=N/2)CCCCCCCC1 |
| InChI | InChI=1S/C18H32N2/c1-2-5-9-13-17(14-10-6-3-1)18-15-11-7-4-8-12-16-19-20-18/h13,18H,1-12,14-16H2/b17-13?,20-19+ |
| InChIKey | ZYARHAPWPJODFU-CVMUMOIMSA-N |
| XLogP | 6.22 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|