About 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol
2-(1-methylimidazol-2-yl)-1,1-diphenylethanol (PubChem CID 771820) has the molecular formula C18H18N2O
and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol.
Molecular Properties
| Compound Name | 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol |
| PubChem CID | 771820 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol |
| SMILES | Cn1ccnc1CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O/c1-20-13-12-19-17(20)14-18(21,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-13,21H,14H2,1H3 |
| InChIKey | JEBPYPNETYWCJE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol?
The IUPAC name of 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol (CID 771820) is 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol.
What is the SMILES notation for 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol?
The canonical SMILES for 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol is Cn1ccnc1CC(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol?
The InChIKey is JEBPYPNETYWCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O/c1-20-13-12-19-17(20)14-18(21,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-13,21H,14H2,1H3.
What are the key properties of 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol?
2-(1-methylimidazol-2-yl)-1,1-diphenylethanol has a molecular weight of 278.36 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylimidazol-2-yl)-1,1-diphenylethanol is sourced from PubChem (CID 771820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).