C33H34Cl2F2N6O4S — CID 77183357
2-[[3-chloro-4-[[5-[2-(4-chloro-3-methoxyphenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-5-fluorobenzoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 77183357) has the molecular formula C33H34Cl2F2N6O4S and a molecular weight of 719.64 g/mol. Its IUPAC name is 2-[[3-chloro-4-[[5-[2-(4-chloro-3-methoxyphenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-5-fluorobenzoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[3-chloro-4-[[5-[2-(4-chloro-3-methoxyphenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-5-fluorobenzoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 77183357 |
| Molecular Formula | C33H34Cl2F2N6O4S |
| Molecular Weight | 719.64 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | 2-[[3-chloro-4-[[5-[2-(4-chloro-3-methoxyphenyl)propan-2-yl]-1-(4-fluorophenyl)imidazol-2-yl]sulfanylmethyl]-5-fluorobenzoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | COc1cc(C(C)(C)c2cnc(SCc3c(F)cc(C(=O)NC(CCCN=C(N)N)C(=O)O)cc3Cl)n2-c2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C33H34Cl2F2N6O4S/c1-33(2,19-6-11-23(34)27(15-19)47-3)28-16-41-32(43(28)21-9-7-20(36)8-10-21)48-17-22-24(35)13-18(14-25(22)37)29(44)42-26(30(45)46)5-4-12-40-31(38)39/h6-11,13-16,26H,4-5,12,17H2,1-3H3,(H,42,44)(H,45,46)(H4,38,39,40) |
| InChIKey | PDVULZSXTCGGMS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|