About N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine
N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine (PubChem CID 771836) has the molecular formula C16H13N5O2S
and a molecular weight of 339.38 g/mol. Its IUPAC name is N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine.
Molecular Properties
| Compound Name | N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine |
| PubChem CID | 771836 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(C=Nn2cnnc2SCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H13N5O2S/c22-21(23)15-8-6-13(7-9-15)10-18-20-12-17-19-16(20)24-11-14-4-2-1-3-5-14/h1-10,12H,11H2 |
| InChIKey | ATHCXGFJQKMRRF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine?
The IUPAC name of N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine (CID 771836) is N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine.
What is the SMILES notation for N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine?
The canonical SMILES for N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine is O=[N+]([O-])c1ccc(C=Nn2cnnc2SCc2ccccc2)cc1.
What is the InChIKey of N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine?
The InChIKey is ATHCXGFJQKMRRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5O2S/c22-21(23)15-8-6-13(7-9-15)10-18-20-12-17-19-16(20)24-11-14-4-2-1-3-5-14/h1-10,12H,11H2.
What are the key properties of N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine?
N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine has a molecular weight of 339.38 g/mol, XLogP of 3.36, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine is sourced from PubChem (CID 771836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).