C17H14ClN3O6 — CID 7718489
[(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 2-chloro-4-nitrobenzoate (PubChem CID 7718489) has the molecular formula C17H14ClN3O6 and a molecular weight of 391.77 g/mol. Its IUPAC name is [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 2-chloro-4-nitrobenzoate.
| Compound Name | [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 7718489 |
| Molecular Formula | C17H14ClN3O6 |
| Molecular Weight | 391.77 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 2-chloro-4-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C17H14ClN3O6/c1-9(16(23)20-11-4-2-10(3-5-11)15(19)22)27-17(24)13-7-6-12(21(25)26)8-14(13)18/h2-9H,1H3,(H2,19,22)(H,20,23)/t9-/m1/s1 |
| InChIKey | YGKZGWDZQSRROY-SECBINFHSA-N |
| XLogP | 2.53 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.77 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|