C27H41NO2 — CID 77189356
6',11,12b-trimethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-naphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one (PubChem CID 77189356) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is 6',11,12b-trimethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-naphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one.
| Compound Name | 6',11,12b-trimethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-naphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one |
|---|---|
| PubChem CID | 77189356 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | 6',11,12b-trimethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-naphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one |
| SMILES | CC1=C2CC3C(CCC4CC(=O)CCC43C)C2CCC2(C1)CC1NCC(C)CC1O2 |
| InChI | InChI=1S/C27H41NO2/c1-16-10-25-24(28-15-16)14-27(30-25)9-7-20-21-5-4-18-11-19(29)6-8-26(18,3)23(21)12-22(20)17(2)13-27/h16,18,20-21,23-25,28H,4-15H2,1-3H3 |
| InChIKey | DWKFVVMIJUVVBV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|