C12H18N2O6 — CID 77190669
1-[5-(3,4-dihydroxybut-1-enyl)pyrazin-2-yl]butane-1,1,2,2-tetrol (PubChem CID 77190669) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is 1-[5-(3,4-dihydroxybut-1-enyl)pyrazin-2-yl]butane-1,1,2,2-tetrol.
| Compound Name | 1-[5-(3,4-dihydroxybut-1-enyl)pyrazin-2-yl]butane-1,1,2,2-tetrol |
|---|---|
| PubChem CID | 77190669 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-[5-(3,4-dihydroxybut-1-enyl)pyrazin-2-yl]butane-1,1,2,2-tetrol |
| SMILES | CCC(O)(O)C(O)(O)c1cnc(C=CC(O)CO)cn1 |
| InChI | InChI=1S/C12H18N2O6/c1-2-11(17,18)12(19,20)10-6-13-8(5-14-10)3-4-9(16)7-15/h3-6,9,15-20H,2,7H2,1H3 |
| InChIKey | VAZUMFXOETZNFX-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|