About 4-anilinoquinoline-3,6-dicarboxylic acid
4-anilinoquinoline-3,6-dicarboxylic acid (PubChem CID 7719081) has the molecular formula C17H12N2O4
and a molecular weight of 308.29 g/mol. Its IUPAC name is 4-anilinoquinoline-3,6-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-anilinoquinoline-3,6-dicarboxylic acid |
| PubChem CID | 7719081 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-anilinoquinoline-3,6-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2ncc(C(=O)O)c(Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C17H12N2O4/c20-16(21)10-6-7-14-12(8-10)15(13(9-18-14)17(22)23)19-11-4-2-1-3-5-11/h1-9H,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | KKFXVJKKIUBOKR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-anilinoquinoline-3,6-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilinoquinoline-3,6-dicarboxylic acid?
The IUPAC name of 4-anilinoquinoline-3,6-dicarboxylic acid (CID 7719081) is 4-anilinoquinoline-3,6-dicarboxylic acid.
What is the SMILES notation for 4-anilinoquinoline-3,6-dicarboxylic acid?
The canonical SMILES for 4-anilinoquinoline-3,6-dicarboxylic acid is O=C(O)c1ccc2ncc(C(=O)O)c(Nc3ccccc3)c2c1.
What is the InChIKey of 4-anilinoquinoline-3,6-dicarboxylic acid?
The InChIKey is KKFXVJKKIUBOKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O4/c20-16(21)10-6-7-14-12(8-10)15(13(9-18-14)17(22)23)19-11-4-2-1-3-5-11/h1-9H,(H,18,19)(H,20,21)(H,22,23).
What are the key properties of 4-anilinoquinoline-3,6-dicarboxylic acid?
4-anilinoquinoline-3,6-dicarboxylic acid has a molecular weight of 308.29 g/mol, XLogP of 3.37, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilinoquinoline-3,6-dicarboxylic acid is sourced from PubChem (CID 7719081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).