About [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate
[2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate (PubChem CID 77192303) has the molecular formula C31H32N2O3
and a molecular weight of 480.61 g/mol. Its IUPAC name is [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate.
Molecular Properties
| Compound Name | [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate |
| PubChem CID | 77192303 |
| Molecular Formula | C31H32N2O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate |
| SMILES | Cc1c(COC(=O)C(C)c2ccccc2)cccc1C(C)c1cn(C(=O)CCc2ccccc2)cn1 |
| InChI | InChI=1S/C31H32N2O3/c1-22-27(20-36-31(35)23(2)26-13-8-5-9-14-26)15-10-16-28(22)24(3)29-19-33(21-32-29)30(34)18-17-25-11-6-4-7-12-25/h4-16,19,21,23-24H,17-18,20H2,1-3H3 |
| InChIKey | PPKXDSFAMKWUBK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate?
The IUPAC name of [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate (CID 77192303) is [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate.
What is the SMILES notation for [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate?
The canonical SMILES for [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate is Cc1c(COC(=O)C(C)c2ccccc2)cccc1C(C)c1cn(C(=O)CCc2ccccc2)cn1.
What is the InChIKey of [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate?
The InChIKey is PPKXDSFAMKWUBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H32N2O3/c1-22-27(20-36-31(35)23(2)26-13-8-5-9-14-26)15-10-16-28(22)24(3)29-19-33(21-32-29)30(34)18-17-25-11-6-4-7-12-25/h4-16,19,21,23-24H,17-18,20H2,1-3H3.
What are the key properties of [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate?
[2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate has a molecular weight of 480.61 g/mol, XLogP of 6.46, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-3-[1-[1-(3-phenylpropanoyl)imidazol-4-yl]ethyl]phenyl]methyl 2-phenylpropanoate is sourced from PubChem (CID 77192303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).