C20H18N3O3- — CID 7719257
4-anilino-8-morpholin-4-ylquinoline-3-carboxylate (PubChem CID 7719257) has the molecular formula C20H18N3O3- and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-anilino-8-morpholin-4-ylquinoline-3-carboxylate.
| Compound Name | 4-anilino-8-morpholin-4-ylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7719257 |
| Molecular Formula | C20H18N3O3- |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-anilino-8-morpholin-4-ylquinoline-3-carboxylate |
| SMILES | O=C([O-])c1cnc2c(N3CCOCC3)cccc2c1Nc1ccccc1 |
| InChI | InChI=1S/C20H19N3O3/c24-20(25)16-13-21-19-15(18(16)22-14-5-2-1-3-6-14)7-4-8-17(19)23-9-11-26-12-10-23/h1-8,13H,9-12H2,(H,21,22)(H,24,25)/p-1 |
| InChIKey | NKXJXANEDBQVJT-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |