C26H38N4O4 — CID 77197961
N-[8-[2-(2,2-dimethoxyethylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-oxo-1-propan-2-ylquinoline-3-carboxamide (PubChem CID 77197961) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is N-[8-[2-(2,2-dimethoxyethylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-oxo-1-propan-2-ylquinoline-3-carboxamide.
| Compound Name | N-[8-[2-(2,2-dimethoxyethylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-oxo-1-propan-2-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 77197961 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | N-[8-[2-(2,2-dimethoxyethylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-oxo-1-propan-2-ylquinoline-3-carboxamide |
| SMILES | COC(CNCCN1C2CCC1CC(NC(=O)c1cc3ccccc3n(C(C)C)c1=O)C2)OC |
| InChI | InChI=1S/C26H38N4O4/c1-17(2)30-23-8-6-5-7-18(23)13-22(26(30)32)25(31)28-19-14-20-9-10-21(15-19)29(20)12-11-27-16-24(33-3)34-4/h5-8,13,17,19-21,24,27H,9-12,14-16H2,1-4H3,(H,28,31) |
| InChIKey | YJCJFALCPWFCIX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|