C25H25ClF2NO5PS — CID 77199648
[[1-(5-chloro-1-benzothiophen-3-yl)-2-[2-(2,5-difluorophenyl)ethenylamino]-2-oxoethyl]-methylphosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 77199648) has the molecular formula C25H25ClF2NO5PS and a molecular weight of 555.97 g/mol. Its IUPAC name is [[1-(5-chloro-1-benzothiophen-3-yl)-2-[2-(2,5-difluorophenyl)ethenylamino]-2-oxoethyl]-methylphosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[1-(5-chloro-1-benzothiophen-3-yl)-2-[2-(2,5-difluorophenyl)ethenylamino]-2-oxoethyl]-methylphosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 77199648 |
| Molecular Formula | C25H25ClF2NO5PS |
| Molecular Weight | 555.97 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | [[1-(5-chloro-1-benzothiophen-3-yl)-2-[2-(2,5-difluorophenyl)ethenylamino]-2-oxoethyl]-methylphosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(C)(=O)C(C(=O)NC=Cc1cc(F)ccc1F)c1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C25H25ClF2NO5PS/c1-25(2,3)24(31)33-14-34-35(4,32)22(19-13-36-21-8-5-16(26)12-18(19)21)23(30)29-10-9-15-11-17(27)6-7-20(15)28/h5-13,22H,14H2,1-4H3,(H,29,30) |
| InChIKey | HNIQIPBRYGSGTK-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.97 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|