C17H32N3+ — CID 77199805
7-(cyclodecen-1-yl)-1,2,3,4,5,8,9,10-octahydro-1,4,7-triazecin-7-ium (PubChem CID 77199805) has the molecular formula C17H32N3+ and a molecular weight of 278.46 g/mol. Its IUPAC name is 7-(cyclodecen-1-yl)-1,2,3,4,5,8,9,10-octahydro-1,4,7-triazecin-7-ium.
| Compound Name | 7-(cyclodecen-1-yl)-1,2,3,4,5,8,9,10-octahydro-1,4,7-triazecin-7-ium |
|---|---|
| PubChem CID | 77199805 |
| Molecular Formula | C17H32N3+ |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 7-(cyclodecen-1-yl)-1,2,3,4,5,8,9,10-octahydro-1,4,7-triazecin-7-ium |
| SMILES | C1=C(/[N+]2=C/CNCCNCCC2)CCCCCCCC1 |
| InChI | InChI=1S/C17H32N3/c1-2-4-6-9-17(10-7-5-3-1)20-15-8-11-18-12-13-19-14-16-20/h9,16,18-19H,1-8,10-15H2/q+1/b17-9?,20-16+ |
| InChIKey | AHKZVQZKNIAUNX-LUNAVQQNSA-N |
| XLogP | 2.67 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|