C28H28N8O3 — CID 77200247
3-(4-methylpiperazin-1-yl)-1-[6-morpholin-4-yl-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]prop-2-en-1-one (PubChem CID 77200247) has the molecular formula C28H28N8O3 and a molecular weight of 524.59 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-1-[6-morpholin-4-yl-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]prop-2-en-1-one.
| Compound Name | 3-(4-methylpiperazin-1-yl)-1-[6-morpholin-4-yl-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 77200247 |
| Molecular Formula | C28H28N8O3 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-1-[6-morpholin-4-yl-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]prop-2-en-1-one |
| SMILES | CN1CCN(C=CC(=O)c2cnc3oc4c(N5CCOCC5)nc(-c5ccnc6[nH]ccc56)nc4c3c2)CC1 |
| InChI | InChI=1S/C28H28N8O3/c1-34-8-10-35(11-9-34)7-4-22(37)18-16-21-23-24(39-28(21)31-17-18)27(36-12-14-38-15-13-36)33-26(32-23)20-3-6-30-25-19(20)2-5-29-25/h2-7,16-17H,8-15H2,1H3,(H,29,30) |
| InChIKey | DYWMVQKHUHMQKO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|