About 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene
4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene (PubChem CID 77211482) has the molecular formula C20H36N2
and a molecular weight of 304.52 g/mol. Its IUPAC name is 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene.
Molecular Properties
| Compound Name | 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene |
| PubChem CID | 77211482 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene |
| SMILES | C1=C(C2=NCNCCCCCCC2)CCCCCCCCC1 |
| InChI | InChI=1S/C20H36N2/c1-2-4-7-11-15-19(14-10-6-3-1)20-16-12-8-5-9-13-17-21-18-22-20/h14,21H,1-13,15-18H2 |
| InChIKey | ORMSVQRDKUELGM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene?
The IUPAC name of 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene (CID 77211482) is 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene.
What is the SMILES notation for 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene?
The canonical SMILES for 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene is C1=C(C2=NCNCCCCCCC2)CCCCCCCCC1.
What is the InChIKey of 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene?
The InChIKey is ORMSVQRDKUELGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36N2/c1-2-4-7-11-15-19(14-10-6-3-1)20-16-12-8-5-9-13-17-21-18-22-20/h14,21H,1-13,15-18H2.
What are the key properties of 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene?
4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene has a molecular weight of 304.52 g/mol, XLogP of 5.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cycloundecen-1-yl)-1,3-diazacycloundec-3-ene is sourced from PubChem (CID 77211482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).