C19H16ClNO3S — CID 7721164
2-(2-chlorophenoxy)ethyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 7721164) has the molecular formula C19H16ClNO3S and a molecular weight of 373.86 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | 2-(2-chlorophenoxy)ethyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 7721164 |
| Molecular Formula | C19H16ClNO3S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)OCCOc1ccccc1Cl |
| InChI | InChI=1S/C19H16ClNO3S/c1-13-17(25-18(21-13)14-7-3-2-4-8-14)19(22)24-12-11-23-16-10-6-5-9-15(16)20/h2-10H,11-12H2,1H3 |
| InChIKey | JVVKLWPGBSQXKS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|