C21H21N3O3S3 — CID 77215394
N-(1-benzothiophen-2-yl)-N-(2-cyclopropylethyl)-4-(5-oxo-1,2,4-thiadiazolidin-3-yl)benzenesulfonamide (PubChem CID 77215394) has the molecular formula C21H21N3O3S3 and a molecular weight of 459.62 g/mol. Its IUPAC name is N-(1-benzothiophen-2-yl)-N-(2-cyclopropylethyl)-4-(5-oxo-1,2,4-thiadiazolidin-3-yl)benzenesulfonamide.
| Compound Name | N-(1-benzothiophen-2-yl)-N-(2-cyclopropylethyl)-4-(5-oxo-1,2,4-thiadiazolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 77215394 |
| Molecular Formula | C21H21N3O3S3 |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | N-(1-benzothiophen-2-yl)-N-(2-cyclopropylethyl)-4-(5-oxo-1,2,4-thiadiazolidin-3-yl)benzenesulfonamide |
| SMILES | O=C1NC(c2ccc(S(=O)(=O)N(CCC3CC3)c3cc4ccccc4s3)cc2)NS1 |
| InChI | InChI=1S/C21H21N3O3S3/c25-21-22-20(23-29-21)15-7-9-17(10-8-15)30(26,27)24(12-11-14-5-6-14)19-13-16-3-1-2-4-18(16)28-19/h1-4,7-10,13-14,20,23H,5-6,11-12H2,(H,22,25) |
| InChIKey | YRTDXNISTPYFMQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|