About methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate
methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate (PubChem CID 77221156) has the molecular formula C19H21NO5
and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate |
| PubChem CID | 77221156 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc2c(c1)C(=O)CC1(CCCN(C(C)=O)C1)O2 |
| InChI | InChI=1S/C19H21NO5/c1-13(21)20-9-3-8-19(12-20)11-16(22)15-10-14(4-6-17(15)25-19)5-7-18(23)24-2/h4-7,10H,3,8-9,11-12H2,1-2H3 |
| InChIKey | CEANUWVNQSEDSN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate?
The IUPAC name of methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate (CID 77221156) is methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate.
What is the SMILES notation for methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate?
The canonical SMILES for methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate is COC(=O)C=Cc1ccc2c(c1)C(=O)CC1(CCCN(C(C)=O)C1)O2.
What is the InChIKey of methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate?
The InChIKey is CEANUWVNQSEDSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO5/c1-13(21)20-9-3-8-19(12-20)11-16(22)15-10-14(4-6-17(15)25-19)5-7-18(23)24-2/h4-7,10H,3,8-9,11-12H2,1-2H3.
What are the key properties of methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate?
methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate has a molecular weight of 343.38 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1'-acetyl-4-oxospiro[3H-chromene-2,3'-piperidine]-6-yl)prop-2-enoate is sourced from PubChem (CID 77221156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).