About [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate
[(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate (PubChem CID 7722188) has the molecular formula C17H13BrClNO3
and a molecular weight of 394.65 g/mol. Its IUPAC name is [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate.
Molecular Properties
| Compound Name | [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate |
| PubChem CID | 7722188 |
| Molecular Formula | C17H13BrClNO3 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate |
| SMILES | O=C(OC[C@H]1CC(c2ccc(Cl)cc2)=NO1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H13BrClNO3/c18-13-5-1-12(2-6-13)17(21)22-10-15-9-16(20-23-15)11-3-7-14(19)8-4-11/h1-8,15H,9-10H2/t15-/m1/s1 |
| InChIKey | OTDPPRLDJATCKO-OAHLLOKOSA-N |
| XLogP | 4.45 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate?
The IUPAC name of [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate (CID 7722188) is [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate.
What is the SMILES notation for [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate?
The canonical SMILES for [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate is O=C(OC[C@H]1CC(c2ccc(Cl)cc2)=NO1)c1ccc(Br)cc1.
What is the InChIKey of [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate?
The InChIKey is OTDPPRLDJATCKO-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H13BrClNO3/c18-13-5-1-12(2-6-13)17(21)22-10-15-9-16(20-23-15)11-3-7-14(19)8-4-11/h1-8,15H,9-10H2/t15-/m1/s1.
What are the key properties of [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate?
[(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate has a molecular weight of 394.65 g/mol, XLogP of 4.45, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate is sourced from PubChem (CID 7722188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).