6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid

C7H7NO5 — CID 77223286

IUPAC6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid
SMILESO=C(O)C1CC=CC(=O)N1C(=O)O
InChIInChI=1S/C7H7NO5/c9-5-3-1-2-4(6(10)11)8(5)7(12)13/h1,3-4H,2H2,(H,10,11)(H,12,13)
InChIKeyDMSKOAYKFBLZHS-UHFFFAOYSA-N
MW185.13 g/mol
LogP-0.09
Rot. Bonds1

About 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid

6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid (PubChem CID 77223286) has the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. Its IUPAC name is 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid.

Molecular Properties

Compound Name6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid
PubChem CID77223286
Molecular FormulaC7H7NO5
Molecular Weight185.13 g/mol
Exact Mass185.03
IUPAC Name6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid
SMILESO=C(O)C1CC=CC(=O)N1C(=O)O
InChIInChI=1S/C7H7NO5/c9-5-3-1-2-4(6(10)11)8(5)7(12)13/h1,3-4H,2H2,(H,10,11)(H,12,13)
InChIKeyDMSKOAYKFBLZHS-UHFFFAOYSA-N
XLogP-0.09
TPSA94.91 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.13
LogP ≤ 5-0.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid?
The IUPAC name of 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid (CID 77223286) is 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid.
What is the SMILES notation for 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid?
The canonical SMILES for 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid is O=C(O)C1CC=CC(=O)N1C(=O)O.
What is the InChIKey of 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid?
The InChIKey is DMSKOAYKFBLZHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO5/c9-5-3-1-2-4(6(10)11)8(5)7(12)13/h1,3-4H,2H2,(H,10,11)(H,12,13).
What are the key properties of 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid?
6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid has a molecular weight of 185.13 g/mol, XLogP of -0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid is sourced from PubChem (CID 77223286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).