C21H28Cl2N4O5S — CID 77224773
N-(3,4-dichlorophenyl)-4-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-7-methyl-6-oxo-1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxamide (PubChem CID 77224773) has the molecular formula C21H28Cl2N4O5S and a molecular weight of 519.45 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-7-methyl-6-oxo-1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-7-methyl-6-oxo-1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxamide |
|---|---|
| PubChem CID | 77224773 |
| Molecular Formula | C21H28Cl2N4O5S |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-7-methyl-6-oxo-1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxamide |
| SMILES | CC1C(=O)N2C(CCN3CCS(=O)(=O)CC3)COCC2CN1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H28Cl2N4O5S/c1-14-20(28)27-16(4-5-25-6-8-33(30,31)9-7-25)12-32-13-17(27)11-26(14)21(29)24-15-2-3-18(22)19(23)10-15/h2-3,10,14,16-17H,4-9,11-13H2,1H3,(H,24,29) |
| InChIKey | WGMHZHASZKAATJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |