C20H20FNO2 — CID 77225367
N-[2-(4-fluorophenyl)-2-methylpropyl]-2-oxo-4-phenylbut-3-enamide (PubChem CID 77225367) has the molecular formula C20H20FNO2 and a molecular weight of 325.38 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-methylpropyl]-2-oxo-4-phenylbut-3-enamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-methylpropyl]-2-oxo-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 77225367 |
| Molecular Formula | C20H20FNO2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-methylpropyl]-2-oxo-4-phenylbut-3-enamide |
| SMILES | CC(C)(CNC(=O)C(=O)C=Cc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FNO2/c1-20(2,16-9-11-17(21)12-10-16)14-22-19(24)18(23)13-8-15-6-4-3-5-7-15/h3-13H,14H2,1-2H3,(H,22,24) |
| InChIKey | GZIXQGUVXZHWIE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|