C18H10Cl2N2O2 — CID 77227036
2,3-bis(4-chlorophenyl)-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione (PubChem CID 77227036) has the molecular formula C18H10Cl2N2O2 and a molecular weight of 357.20 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione.
| Compound Name | 2,3-bis(4-chlorophenyl)-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
|---|---|
| PubChem CID | 77227036 |
| Molecular Formula | C18H10Cl2N2O2 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
| SMILES | O=C1Nc2c([nH]c(-c3ccc(Cl)cc3)c2-c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C18H10Cl2N2O2/c19-11-5-1-9(2-6-11)13-14(10-3-7-12(20)8-4-10)21-16-15(13)22-18(24)17(16)23/h1-8,21H,(H,22,23,24) |
| InChIKey | BNVRZOSRYDBNFB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|