About CID 77227705
CID 77227705 (PubChem CID 77227705) has the molecular formula C35H47F3N2O4Si
and a molecular weight of 644.85 g/mol.
Molecular Properties
| Compound Name | CID 77227705 |
| PubChem CID | 77227705 |
| Molecular Formula | C35H47F3N2O4Si |
| Molecular Weight | 644.85 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC2(CCC2)Cc2nc(C3CCOCC3)c3c(c21)C1(CCOCC1)OC3c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C35H47F3N2O4Si/c1-32(2,3)45(4,5)44-25-20-33(11-6-12-33)19-24-27(25)29-28(30(40-24)22-9-15-41-16-10-22)31(43-34(29)13-17-42-18-14-34)23-7-8-26(39-21-23)35(36,37)38/h7-8,21-22,25,31H,6,9-20H2,1-5H3 |
| InChIKey | IPYYZQSQMWMZQF-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 644.85 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 77227705 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 77227705?
The IUPAC name of CID 77227705 (CID 77227705) is not available.
What is the SMILES notation for CID 77227705?
The canonical SMILES for CID 77227705 is CC(C)(C)[Si](C)(C)OC1CC2(CCC2)Cc2nc(C3CCOCC3)c3c(c21)C1(CCOCC1)OC3c1ccc(C(F)(F)F)nc1.
What is the InChIKey of CID 77227705?
The InChIKey is IPYYZQSQMWMZQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H47F3N2O4Si/c1-32(2,3)45(4,5)44-25-20-33(11-6-12-33)19-24-27(25)29-28(30(40-24)22-9-15-41-16-10-22)31(43-34(29)13-17-42-18-14-34)23-7-8-26(39-21-23)35(36,37)38/h7-8,21-22,25,31H,6,9-20H2,1-5H3.
What are the key properties of CID 77227705?
CID 77227705 has a molecular weight of 644.85 g/mol, XLogP of 8.69, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 77227705 is sourced from PubChem (CID 77227705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).