C9H13N7 — CID 77230784
8-piperazin-1-yl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (PubChem CID 77230784) has the molecular formula C9H13N7 and a molecular weight of 219.25 g/mol. Its IUPAC name is 8-piperazin-1-yl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine.
| Compound Name | 8-piperazin-1-yl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
|---|---|
| PubChem CID | 77230784 |
| Molecular Formula | C9H13N7 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 8-piperazin-1-yl-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| SMILES | Nc1nc2c(N3CCNCC3)nccn2n1 |
| InChI | InChI=1S/C9H13N7/c10-9-13-8-7(12-3-6-16(8)14-9)15-4-1-11-2-5-15/h3,6,11H,1-2,4-5H2,(H2,10,14) |
| InChIKey | OCKTTZSUIIMTPA-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 84.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |