About 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol
1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol (PubChem CID 77230811) has the molecular formula C9H7BrClNOS
and a molecular weight of 292.59 g/mol. Its IUPAC name is 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol.
Molecular Properties
| Compound Name | 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol |
| PubChem CID | 77230811 |
| Molecular Formula | C9H7BrClNOS |
| Molecular Weight | 292.59 g/mol |
| Exact Mass | 290.91 |
| IUPAC Name | 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol |
| SMILES | CC(O)c1cc2cc(Br)sc2nc1Cl |
| InChI | InChI=1S/C9H7BrClNOS/c1-4(13)6-2-5-3-7(10)14-9(5)12-8(6)11/h2-4,13H,1H3 |
| InChIKey | LNENWYQVQQGXMZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol?
The IUPAC name of 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol (CID 77230811) is 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol.
What is the SMILES notation for 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol?
The canonical SMILES for 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol is CC(O)c1cc2cc(Br)sc2nc1Cl.
What is the InChIKey of 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol?
The InChIKey is LNENWYQVQQGXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrClNOS/c1-4(13)6-2-5-3-7(10)14-9(5)12-8(6)11/h2-4,13H,1H3.
What are the key properties of 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol?
1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol has a molecular weight of 292.59 g/mol, XLogP of 3.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-6-chlorothieno[2,3-b]pyridin-5-yl)ethanol is sourced from PubChem (CID 77230811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).