About 4-chloro-2,6-diphenylpyridine
4-chloro-2,6-diphenylpyridine (PubChem CID 77230921) has the molecular formula C17H12ClN
and a molecular weight of 265.74 g/mol. Its IUPAC name is 4-chloro-2,6-diphenylpyridine.
Molecular Properties
| Compound Name | 4-chloro-2,6-diphenylpyridine |
| PubChem CID | 77230921 |
| Molecular Formula | C17H12ClN |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-chloro-2,6-diphenylpyridine |
| SMILES | Clc1cc(-c2ccccc2)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C17H12ClN/c18-15-11-16(13-7-3-1-4-8-13)19-17(12-15)14-9-5-2-6-10-14/h1-12H |
| InChIKey | UKWOXPOLLIJKQZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2,6-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,6-diphenylpyridine?
The IUPAC name of 4-chloro-2,6-diphenylpyridine (CID 77230921) is 4-chloro-2,6-diphenylpyridine.
What is the SMILES notation for 4-chloro-2,6-diphenylpyridine?
The canonical SMILES for 4-chloro-2,6-diphenylpyridine is Clc1cc(-c2ccccc2)nc(-c2ccccc2)c1.
What is the InChIKey of 4-chloro-2,6-diphenylpyridine?
The InChIKey is UKWOXPOLLIJKQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClN/c18-15-11-16(13-7-3-1-4-8-13)19-17(12-15)14-9-5-2-6-10-14/h1-12H.
What are the key properties of 4-chloro-2,6-diphenylpyridine?
4-chloro-2,6-diphenylpyridine has a molecular weight of 265.74 g/mol, XLogP of 5.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,6-diphenylpyridine is sourced from PubChem (CID 77230921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).