C15H24BrN3O — CID 77231001
4-[[1-(6-bromo-2-pyridinyl)azepan-4-yl]amino]butan-1-ol (PubChem CID 77231001) has the molecular formula C15H24BrN3O and a molecular weight of 342.28 g/mol. Its IUPAC name is 4-[[1-(6-bromo-2-pyridinyl)azepan-4-yl]amino]butan-1-ol.
| Compound Name | 4-[[1-(6-bromo-2-pyridinyl)azepan-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 77231001 |
| Molecular Formula | C15H24BrN3O |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-[[1-(6-bromo-2-pyridinyl)azepan-4-yl]amino]butan-1-ol |
| SMILES | OCCCCNC1CCCN(c2cccc(Br)n2)CC1 |
| InChI | InChI=1S/C15H24BrN3O/c16-14-6-3-7-15(18-14)19-10-4-5-13(8-11-19)17-9-1-2-12-20/h3,6-7,13,17,20H,1-2,4-5,8-12H2 |
| InChIKey | SOPALEVVRTVJMG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|