About 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal
4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal (PubChem CID 77231150) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal.
Molecular Properties
| Compound Name | 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal |
| PubChem CID | 77231150 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal |
| SMILES | O=CCCCC1COCCC12OCCO2 |
| InChI | InChI=1S/C11H18O4/c12-5-2-1-3-10-9-13-6-4-11(10)14-7-8-15-11/h5,10H,1-4,6-9H2 |
| InChIKey | JKFDTVNZZKMPBW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal?
The IUPAC name of 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal (CID 77231150) is 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal.
What is the SMILES notation for 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal?
The canonical SMILES for 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal is O=CCCCC1COCCC12OCCO2.
What is the InChIKey of 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal?
The InChIKey is JKFDTVNZZKMPBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c12-5-2-1-3-10-9-13-6-4-11(10)14-7-8-15-11/h5,10H,1-4,6-9H2.
What are the key properties of 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal?
4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal has a molecular weight of 214.26 g/mol, XLogP of 1.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)butanal is sourced from PubChem (CID 77231150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).