C22H28ClN5O5S2 — CID 77232207
(2S)-N-[2-[(2-amino-2-sulfanylethyl)amino]-2-oxoethyl]-2-[[(2S)-2-(3-chlorophenyl)-2-(methanesulfonamido)acetyl]amino]-3-phenylpropanamide (PubChem CID 77232207) has the molecular formula C22H28ClN5O5S2 and a molecular weight of 542.08 g/mol. Its IUPAC name is (2S)-N-[2-[(2-amino-2-sulfanylethyl)amino]-2-oxoethyl]-2-[[(2S)-2-(3-chlorophenyl)-2-(methanesulfonamido)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[2-[(2-amino-2-sulfanylethyl)amino]-2-oxoethyl]-2-[[(2S)-2-(3-chlorophenyl)-2-(methanesulfonamido)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 77232207 |
| Molecular Formula | C22H28ClN5O5S2 |
| Molecular Weight | 542.08 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | (2S)-N-[2-[(2-amino-2-sulfanylethyl)amino]-2-oxoethyl]-2-[[(2S)-2-(3-chlorophenyl)-2-(methanesulfonamido)acetyl]amino]-3-phenylpropanamide |
| SMILES | CS(=O)(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)NCC(N)S)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H28ClN5O5S2/c1-35(32,33)28-20(15-8-5-9-16(23)11-15)22(31)27-17(10-14-6-3-2-4-7-14)21(30)26-13-19(29)25-12-18(24)34/h2-9,11,17-18,20,28,34H,10,12-13,24H2,1H3,(H,25,29)(H,26,30)(H,27,31)/t17-,18?,20-/m0/s1 |
| InChIKey | PPHTUQOEJXQTJS-DXCJPMOASA-N |
| XLogP | 0.10 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.08 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|