C33H45N3O2S — CID 77232726
4,4,6a,6b,11,11,14b-heptamethyl-8a-(5-methyl-1,3,4-thiadiazol-2-yl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile (PubChem CID 77232726) has the molecular formula C33H45N3O2S and a molecular weight of 547.81 g/mol. Its IUPAC name is 4,4,6a,6b,11,11,14b-heptamethyl-8a-(5-methyl-1,3,4-thiadiazol-2-yl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile.
| Compound Name | 4,4,6a,6b,11,11,14b-heptamethyl-8a-(5-methyl-1,3,4-thiadiazol-2-yl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 77232726 |
| Molecular Formula | C33H45N3O2S |
| Molecular Weight | 547.81 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | 4,4,6a,6b,11,11,14b-heptamethyl-8a-(5-methyl-1,3,4-thiadiazol-2-yl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
| SMILES | Cc1nnc(C23CCC(C)(C)CC2C2C(=O)CC4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC4(C)C2(C)CC3)s1 |
| InChI | InChI=1S/C33H45N3O2S/c1-19-35-36-27(39-19)33-13-11-28(2,3)17-21(33)25-22(37)15-24-30(6)16-20(18-34)26(38)29(4,5)23(30)9-10-31(24,7)32(25,8)12-14-33/h16,21,23-25H,9-15,17H2,1-8H3 |
| InChIKey | PUYDZZSBPSKHQR-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 83.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.81 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |