C15H13Cl2NO2 — CID 7723452
(2R)-N-(2,5-dichlorophenyl)-2-phenoxypropanamide (PubChem CID 7723452) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is (2R)-N-(2,5-dichlorophenyl)-2-phenoxypropanamide.
| Compound Name | (2R)-N-(2,5-dichlorophenyl)-2-phenoxypropanamide |
|---|---|
| PubChem CID | 7723452 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | (2R)-N-(2,5-dichlorophenyl)-2-phenoxypropanamide |
| SMILES | C[C@@H](Oc1ccccc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H13Cl2NO2/c1-10(20-12-5-3-2-4-6-12)15(19)18-14-9-11(16)7-8-13(14)17/h2-10H,1H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | YKOXBOBPCKNGSW-SNVBAGLBSA-N |
| XLogP | 4.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |