C16H12F3N5OS — CID 7723486
(2S)-2-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7723486) has the molecular formula C16H12F3N5OS and a molecular weight of 379.37 g/mol. Its IUPAC name is (2S)-2-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7723486 |
| Molecular Formula | C16H12F3N5OS |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (2S)-2-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@H](Sc1n[nH]c(-c2ccncc2)n1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H12F3N5OS/c1-8(15(25)21-11-3-2-10(17)12(18)13(11)19)26-16-22-14(23-24-16)9-4-6-20-7-5-9/h2-8H,1H3,(H,21,25)(H,22,23,24)/t8-/m0/s1 |
| InChIKey | UEKJEDREXWMRME-QMMMGPOBSA-N |
| XLogP | 3.40 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|