C16H12Cl3NO3 — CID 7723787
[2-(3-chloro-4-methylanilino)-2-oxoethyl] 2,6-dichlorobenzoate (PubChem CID 7723787) has the molecular formula C16H12Cl3NO3 and a molecular weight of 372.64 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 7723787 |
| Molecular Formula | C16H12Cl3NO3 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2,6-dichlorobenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2c(Cl)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3NO3/c1-9-5-6-10(7-13(9)19)20-14(21)8-23-16(22)15-11(17)3-2-4-12(15)18/h2-7H,8H2,1H3,(H,20,21) |
| InChIKey | GFXZEZQCRIZWBX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |