C19H19Cl2NO3 — CID 7723994
[2-[[(1S)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate (PubChem CID 7723994) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate.
| Compound Name | [2-[[(1S)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7723994 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [2-[[(1S)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate |
| SMILES | CC[C@H](NC(=O)COC(=O)c1cc(Cl)cc(Cl)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H19Cl2NO3/c1-3-17(13-6-4-12(2)5-7-13)22-18(23)11-25-19(24)14-8-15(20)10-16(21)9-14/h4-10,17H,3,11H2,1-2H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | KLXPOAKNQVGFIW-KRWDZBQOSA-N |
| XLogP | 4.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |