C29H41N3OSi — CID 77240819
1-[2-methyl-4-[(5-methyl-2-pyridinyl)amino]-6-[2-tri(propan-2-yl)silylethynyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 77240819) has the molecular formula C29H41N3OSi and a molecular weight of 475.75 g/mol. Its IUPAC name is 1-[2-methyl-4-[(5-methyl-2-pyridinyl)amino]-6-[2-tri(propan-2-yl)silylethynyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[2-methyl-4-[(5-methyl-2-pyridinyl)amino]-6-[2-tri(propan-2-yl)silylethynyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 77240819 |
| Molecular Formula | C29H41N3OSi |
| Molecular Weight | 475.75 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | 1-[2-methyl-4-[(5-methyl-2-pyridinyl)amino]-6-[2-tri(propan-2-yl)silylethynyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc2C(Nc2ccc(C)cn2)CC1C |
| InChI | InChI=1S/C29H41N3OSi/c1-19(2)34(20(3)4,21(5)6)15-14-25-11-12-28-26(17-25)27(16-23(8)32(28)24(9)33)31-29-13-10-22(7)18-30-29/h10-13,17-21,23,27H,16H2,1-9H3,(H,30,31) |
| InChIKey | XQXJZMDKOOCIPI-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.75 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|