C16H18N2 — CID 772457
(1S,12R)-1,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene (PubChem CID 772457) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (1S,12R)-1,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene.
| Compound Name | (1S,12R)-1,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 772457 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (1S,12R)-1,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)c1nc3ccccc3nc12 |
| InChI | InChI=1S/C16H18N2/c1-15(2)10-8-9-16(15,3)14-13(10)17-11-6-4-5-7-12(11)18-14/h4-7,10H,8-9H2,1-3H3/t10-,16+/m0/s1 |
| InChIKey | NGUAUQBJYSZURH-MGPLVRAMSA-N |
| XLogP | 3.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |