C21H22F3N5S — CID 77247633
N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 77247633) has the molecular formula C21H22F3N5S and a molecular weight of 433.50 g/mol. Its IUPAC name is N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 77247633 |
| Molecular Formula | C21H22F3N5S |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | FC(F)(F)c1cccc(N2CC3CCC(NCc4cn[nH]c4-c4cccs4)C3C2)n1 |
| InChI | InChI=1S/C21H22F3N5S/c22-21(23,24)18-4-1-5-19(27-18)29-11-13-6-7-16(15(13)12-29)25-9-14-10-26-28-20(14)17-3-2-8-30-17/h1-5,8,10,13,15-16,25H,6-7,9,11-12H2,(H,26,28) |
| InChIKey | UDINUYCHHGEFND-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |