C17H14Cl2FNO3 — CID 7724833
[(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-(3,4-dichlorophenyl)acetate (PubChem CID 7724833) has the molecular formula C17H14Cl2FNO3 and a molecular weight of 370.21 g/mol. Its IUPAC name is [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-(3,4-dichlorophenyl)acetate.
| Compound Name | [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 7724833 |
| Molecular Formula | C17H14Cl2FNO3 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-(3,4-dichlorophenyl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1ccc(Cl)c(Cl)c1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14Cl2FNO3/c1-10(17(23)21-13-5-3-12(20)4-6-13)24-16(22)9-11-2-7-14(18)15(19)8-11/h2-8,10H,9H2,1H3,(H,21,23)/t10-/m1/s1 |
| InChIKey | BFUGAZDYYGCFGW-SNVBAGLBSA-N |
| XLogP | 4.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |