C31H28Cl2N2O5 — CID 77251151
methyl 4-[4-[3-[2-[5-[1-(2,4-dichlorophenyl)-2-methoxy-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoate (PubChem CID 77251151) has the molecular formula C31H28Cl2N2O5 and a molecular weight of 579.48 g/mol. Its IUPAC name is methyl 4-[4-[3-[2-[5-[1-(2,4-dichlorophenyl)-2-methoxy-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoate.
| Compound Name | methyl 4-[4-[3-[2-[5-[1-(2,4-dichlorophenyl)-2-methoxy-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 77251151 |
| Molecular Formula | C31H28Cl2N2O5 |
| Molecular Weight | 579.48 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | methyl 4-[4-[3-[2-[5-[1-(2,4-dichlorophenyl)-2-methoxy-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(-c2cccc(C=Cc3ncc(C(C(=O)OC)c4ccc(Cl)cc4Cl)[nH]3)c2)cc1 |
| InChI | InChI=1S/C31H28Cl2N2O5/c1-38-29(36)7-4-16-40-24-12-9-21(10-13-24)22-6-3-5-20(17-22)8-15-28-34-19-27(35-28)30(31(37)39-2)25-14-11-23(32)18-26(25)33/h3,5-6,8-15,17-19,30H,4,7,16H2,1-2H3,(H,34,35) |
| InChIKey | WHMXOFMDCQMFPN-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.48 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|